About 4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol
4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol (PubChem CID 64911146) has the molecular formula C13H18FNO3S
and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol.
Molecular Properties
| Compound Name | 4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol |
| PubChem CID | 64911146 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol |
| SMILES | CC(O)CCNC1CCS(=O)(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C13H18FNO3S/c1-9(16)4-6-15-12-5-7-19(17,18)13-3-2-10(14)8-11(12)13/h2-3,8-9,12,15-16H,4-7H2,1H3 |
| InChIKey | PPTWJSMGMHJILU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol?
The IUPAC name of 4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol (CID 64911146) is 4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol.
What is the SMILES notation for 4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol?
The canonical SMILES for 4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol is CC(O)CCNC1CCS(=O)(=O)c2ccc(F)cc21.
What is the InChIKey of 4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol?
The InChIKey is PPTWJSMGMHJILU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO3S/c1-9(16)4-6-15-12-5-7-19(17,18)13-3-2-10(14)8-11(12)13/h2-3,8-9,12,15-16H,4-7H2,1H3.
What are the key properties of 4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol?
4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol has a molecular weight of 287.36 g/mol, XLogP of 1.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]butan-2-ol is sourced from PubChem (CID 64911146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).