About 2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol
2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol (PubChem CID 64911357) has the molecular formula C9H17F2NO
and a molecular weight of 193.24 g/mol. Its IUPAC name is 2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol |
| PubChem CID | 64911357 |
| Molecular Formula | C9H17F2NO |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol |
| SMILES | OC1CCCCC1CNCC(F)F |
| InChI | InChI=1S/C9H17F2NO/c10-9(11)6-12-5-7-3-1-2-4-8(7)13/h7-9,12-13H,1-6H2 |
| InChIKey | UFWAQJIHAUUDHJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol?
The IUPAC name of 2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol (CID 64911357) is 2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol.
What is the SMILES notation for 2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol?
The canonical SMILES for 2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol is OC1CCCCC1CNCC(F)F.
What is the InChIKey of 2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol?
The InChIKey is UFWAQJIHAUUDHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO/c10-9(11)6-12-5-7-3-1-2-4-8(7)13/h7-9,12-13H,1-6H2.
What are the key properties of 2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol?
2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol has a molecular weight of 193.24 g/mol, XLogP of 1.39, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-difluoroethylamino)methyl]cyclohexan-1-ol is sourced from PubChem (CID 64911357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).