C17H25N3 — CID 6491176
2-[(4-methylpiperidin-1-yl)methyl]-1-propylbenzimidazole (PubChem CID 6491176) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 2-[(4-methylpiperidin-1-yl)methyl]-1-propylbenzimidazole.
| Compound Name | 2-[(4-methylpiperidin-1-yl)methyl]-1-propylbenzimidazole |
|---|---|
| PubChem CID | 6491176 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 2-[(4-methylpiperidin-1-yl)methyl]-1-propylbenzimidazole |
| SMILES | CCCn1c(CN2CCC(C)CC2)nc2ccccc21 |
| InChI | InChI=1S/C17H25N3/c1-3-10-20-16-7-5-4-6-15(16)18-17(20)13-19-11-8-14(2)9-12-19/h4-7,14H,3,8-13H2,1-2H3 |
| InChIKey | ODLRBDPCKJOSDM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |