C23H29N3O9S — CID 649125
N-[4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]sulfonylphenyl]acetamide;oxalic acid (PubChem CID 649125) has the molecular formula C23H29N3O9S and a molecular weight of 523.56 g/mol. Its IUPAC name is N-[4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]sulfonylphenyl]acetamide;oxalic acid.
| Compound Name | N-[4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]sulfonylphenyl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 649125 |
| Molecular Formula | C23H29N3O9S |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | N-[4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]sulfonylphenyl]acetamide;oxalic acid |
| SMILES | COc1ccc(CN2CCN(S(=O)(=O)c3ccc(NC(C)=O)cc3)CC2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H27N3O5S.C2H2O4/c1-16(25)22-18-5-7-19(8-6-18)30(26,27)24-12-10-23(11-13-24)15-17-4-9-20(28-2)21(14-17)29-3;3-1(4)2(5)6/h4-9,14H,10-13,15H2,1-3H3,(H,22,25);(H,3,4)(H,5,6) |
| InChIKey | CXTRIFDLKOZTQQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 162.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|