C14H20BrNO4S — CID 64913301
5-bromo-N-[(2-hydroxycyclohexyl)methyl]-2-methoxybenzenesulfonamide (PubChem CID 64913301) has the molecular formula C14H20BrNO4S and a molecular weight of 378.29 g/mol. Its IUPAC name is 5-bromo-N-[(2-hydroxycyclohexyl)methyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-bromo-N-[(2-hydroxycyclohexyl)methyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 64913301 |
| Molecular Formula | C14H20BrNO4S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 5-bromo-N-[(2-hydroxycyclohexyl)methyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NCC1CCCCC1O |
| InChI | InChI=1S/C14H20BrNO4S/c1-20-13-7-6-11(15)8-14(13)21(18,19)16-9-10-4-2-3-5-12(10)17/h6-8,10,12,16-17H,2-5,9H2,1H3 |
| InChIKey | WZULYXBGYKDSKS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |