C23H29N5O5 — CID 649153
2-[[2-(benzotriazol-1-yl)acetyl]-(oxolan-2-ylmethyl)amino]-N-(2-methoxyethyl)-2-(5-methylfuran-2-yl)acetamide (PubChem CID 649153) has the molecular formula C23H29N5O5 and a molecular weight of 455.52 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-(oxolan-2-ylmethyl)amino]-N-(2-methoxyethyl)-2-(5-methylfuran-2-yl)acetamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(oxolan-2-ylmethyl)amino]-N-(2-methoxyethyl)-2-(5-methylfuran-2-yl)acetamide |
|---|---|
| PubChem CID | 649153 |
| Molecular Formula | C23H29N5O5 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(oxolan-2-ylmethyl)amino]-N-(2-methoxyethyl)-2-(5-methylfuran-2-yl)acetamide |
| SMILES | COCCNC(=O)C(c1ccc(C)o1)N(CC1CCCO1)C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C23H29N5O5/c1-16-9-10-20(33-16)22(23(30)24-11-13-31-2)27(14-17-6-5-12-32-17)21(29)15-28-19-8-4-3-7-18(19)25-26-28/h3-4,7-10,17,22H,5-6,11-15H2,1-2H3,(H,24,30) |
| InChIKey | LFLLYEPHQYHCNG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|