About (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one
(4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one (PubChem CID 6491687) has the molecular formula C16H18N2O4S
and a molecular weight of 334.40 g/mol. Its IUPAC name is (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one.
Molecular Properties
| Compound Name | (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one |
| PubChem CID | 6491687 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one |
| SMILES | COc1ccc(OC)c(/C=C2\N=C(N3CCOCC3)SC2=O)c1 |
| InChI | InChI=1S/C16H18N2O4S/c1-20-12-3-4-14(21-2)11(9-12)10-13-15(19)23-16(17-13)18-5-7-22-8-6-18/h3-4,9-10H,5-8H2,1-2H3/b13-10- |
| InChIKey | DVFMBZHVWYAPLM-RAXLEYEMSA-N |
| XLogP | 2.01 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one?
The IUPAC name of (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one (CID 6491687) is (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one.
What is the SMILES notation for (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one?
The canonical SMILES for (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one is COc1ccc(OC)c(/C=C2\N=C(N3CCOCC3)SC2=O)c1.
What is the InChIKey of (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one?
The InChIKey is DVFMBZHVWYAPLM-RAXLEYEMSA-N. The full InChI is InChI=1S/C16H18N2O4S/c1-20-12-3-4-14(21-2)11(9-12)10-13-15(19)23-16(17-13)18-5-7-22-8-6-18/h3-4,9-10H,5-8H2,1-2H3/b13-10-.
What are the key properties of (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one?
(4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one has a molecular weight of 334.40 g/mol, XLogP of 2.01, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-5-one is sourced from PubChem (CID 6491687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).