About 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine
1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine (PubChem CID 64918858) has the molecular formula C10H16N2S
and a molecular weight of 196.32 g/mol. Its IUPAC name is 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine.
Molecular Properties
| Compound Name | 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
| PubChem CID | 64918858 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
| SMILES | CCC(NCc1cscn1)C1CC1 |
| InChI | InChI=1S/C10H16N2S/c1-2-10(8-3-4-8)11-5-9-6-13-7-12-9/h6-8,10-11H,2-5H2,1H3 |
| InChIKey | GBISPWQSYAXGRX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine?
The IUPAC name of 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine (CID 64918858) is 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine.
What is the SMILES notation for 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine?
The canonical SMILES for 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine is CCC(NCc1cscn1)C1CC1.
What is the InChIKey of 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine?
The InChIKey is GBISPWQSYAXGRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2S/c1-2-10(8-3-4-8)11-5-9-6-13-7-12-9/h6-8,10-11H,2-5H2,1H3.
What are the key properties of 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine?
1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine has a molecular weight of 196.32 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine is sourced from PubChem (CID 64918858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).