C11H15N3 — CID 64919141
N,4-dicyclopropyl-5-methylpyrimidin-2-amine (PubChem CID 64919141) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is N,4-dicyclopropyl-5-methylpyrimidin-2-amine.
| Compound Name | N,4-dicyclopropyl-5-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 64919141 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | N,4-dicyclopropyl-5-methylpyrimidin-2-amine |
| SMILES | Cc1cnc(NC2CC2)nc1C1CC1 |
| InChI | InChI=1S/C11H15N3/c1-7-6-12-11(13-9-4-5-9)14-10(7)8-2-3-8/h6,8-9H,2-5H2,1H3,(H,12,13,14) |
| InChIKey | SEOINLAUJLUJGZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |