C19H20N4O3 — CID 6492010
N-(3-cyclohexyl-2,4-dioxoimidazolidin-1-yl)isoquinoline-1-carboxamide (PubChem CID 6492010) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-(3-cyclohexyl-2,4-dioxoimidazolidin-1-yl)isoquinoline-1-carboxamide.
| Compound Name | N-(3-cyclohexyl-2,4-dioxoimidazolidin-1-yl)isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 6492010 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-(3-cyclohexyl-2,4-dioxoimidazolidin-1-yl)isoquinoline-1-carboxamide |
| SMILES | O=C(NN1CC(=O)N(C2CCCCC2)C1=O)c1nccc2ccccc12 |
| InChI | InChI=1S/C19H20N4O3/c24-16-12-22(19(26)23(16)14-7-2-1-3-8-14)21-18(25)17-15-9-5-4-6-13(15)10-11-20-17/h4-6,9-11,14H,1-3,7-8,12H2,(H,21,25) |
| InChIKey | SPWZQYUMRIBSJI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|