About 1-cyclopropyl-2,4-dimethylpentane-1,3-dione
1-cyclopropyl-2,4-dimethylpentane-1,3-dione (PubChem CID 64920290) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-cyclopropyl-2,4-dimethylpentane-1,3-dione.
Molecular Properties
| Compound Name | 1-cyclopropyl-2,4-dimethylpentane-1,3-dione |
| PubChem CID | 64920290 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1-cyclopropyl-2,4-dimethylpentane-1,3-dione |
| SMILES | CC(C)C(=O)C(C)C(=O)C1CC1 |
| InChI | InChI=1S/C10H16O2/c1-6(2)9(11)7(3)10(12)8-4-5-8/h6-8H,4-5H2,1-3H3 |
| InChIKey | YWXLRVIDNYVXMD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-2,4-dimethylpentane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2,4-dimethylpentane-1,3-dione?
The IUPAC name of 1-cyclopropyl-2,4-dimethylpentane-1,3-dione (CID 64920290) is 1-cyclopropyl-2,4-dimethylpentane-1,3-dione.
What is the SMILES notation for 1-cyclopropyl-2,4-dimethylpentane-1,3-dione?
The canonical SMILES for 1-cyclopropyl-2,4-dimethylpentane-1,3-dione is CC(C)C(=O)C(C)C(=O)C1CC1.
What is the InChIKey of 1-cyclopropyl-2,4-dimethylpentane-1,3-dione?
The InChIKey is YWXLRVIDNYVXMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-6(2)9(11)7(3)10(12)8-4-5-8/h6-8H,4-5H2,1-3H3.
What are the key properties of 1-cyclopropyl-2,4-dimethylpentane-1,3-dione?
1-cyclopropyl-2,4-dimethylpentane-1,3-dione has a molecular weight of 168.24 g/mol, XLogP of 1.83, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2,4-dimethylpentane-1,3-dione is sourced from PubChem (CID 64920290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).