C12H9ClN4O2S — CID 64920454
2-amino-N-(5-chloro-2-cyanophenyl)pyridine-4-sulfonamide (PubChem CID 64920454) has the molecular formula C12H9ClN4O2S and a molecular weight of 308.75 g/mol. Its IUPAC name is 2-amino-N-(5-chloro-2-cyanophenyl)pyridine-4-sulfonamide.
| Compound Name | 2-amino-N-(5-chloro-2-cyanophenyl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 64920454 |
| Molecular Formula | C12H9ClN4O2S |
| Molecular Weight | 308.75 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 2-amino-N-(5-chloro-2-cyanophenyl)pyridine-4-sulfonamide |
| SMILES | N#Cc1ccc(Cl)cc1NS(=O)(=O)c1ccnc(N)c1 |
| InChI | InChI=1S/C12H9ClN4O2S/c13-9-2-1-8(7-14)11(5-9)17-20(18,19)10-3-4-16-12(15)6-10/h1-6,17H,(H2,15,16) |
| InChIKey | ZRQJOWMLQRTZRI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.75 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |