About N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine
N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine (PubChem CID 6492078) has the molecular formula C9H9ClN4
and a molecular weight of 208.65 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine.
Molecular Properties
| Compound Name | N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine |
| PubChem CID | 6492078 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine |
| SMILES | Clc1ccccc1CNc1ncn[nH]1 |
| InChI | InChI=1S/C9H9ClN4/c10-8-4-2-1-3-7(8)5-11-9-12-6-13-14-9/h1-4,6H,5H2,(H2,11,12,13,14) |
| InChIKey | QBNVXKDMCGYOOB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine?
The IUPAC name of N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine (CID 6492078) is N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine.
What is the SMILES notation for N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine?
The canonical SMILES for N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine is Clc1ccccc1CNc1ncn[nH]1.
What is the InChIKey of N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine?
The InChIKey is QBNVXKDMCGYOOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN4/c10-8-4-2-1-3-7(8)5-11-9-12-6-13-14-9/h1-4,6H,5H2,(H2,11,12,13,14).
What are the key properties of N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine?
N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine has a molecular weight of 208.65 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chlorophenyl)methyl]-1H-1,2,4-triazol-5-amine is sourced from PubChem (CID 6492078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).