C9H16N6O2 — CID 6492110
N-[2-[[4-amino-6-(ethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]acetamide (PubChem CID 6492110) has the molecular formula C9H16N6O2 and a molecular weight of 240.27 g/mol. Its IUPAC name is N-[2-[[4-amino-6-(ethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]acetamide.
| Compound Name | N-[2-[[4-amino-6-(ethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]acetamide |
|---|---|
| PubChem CID | 6492110 |
| Molecular Formula | C9H16N6O2 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-[2-[[4-amino-6-(ethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]acetamide |
| SMILES | CCNc1nc(N)nc(OCCNC(C)=O)n1 |
| InChI | InChI=1S/C9H16N6O2/c1-3-11-8-13-7(10)14-9(15-8)17-5-4-12-6(2)16/h3-5H2,1-2H3,(H,12,16)(H3,10,11,13,14,15) |
| InChIKey | IIASPYLAWPOICH-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|