About 9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one
9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one (PubChem CID 64921492) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one.
Molecular Properties
| Compound Name | 9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one |
| PubChem CID | 64921492 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one |
| SMILES | CC1CCC(N2C3CCCC2CC(=O)C3)C1C |
| InChI | InChI=1S/C15H25NO/c1-10-6-7-15(11(10)2)16-12-4-3-5-13(16)9-14(17)8-12/h10-13,15H,3-9H2,1-2H3 |
| InChIKey | UPAPSPFMUBTUMP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one?
The IUPAC name of 9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one (CID 64921492) is 9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one.
What is the SMILES notation for 9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one?
The canonical SMILES for 9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one is CC1CCC(N2C3CCCC2CC(=O)C3)C1C.
What is the InChIKey of 9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one?
The InChIKey is UPAPSPFMUBTUMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-10-6-7-15(11(10)2)16-12-4-3-5-13(16)9-14(17)8-12/h10-13,15H,3-9H2,1-2H3.
What are the key properties of 9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one?
9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one has a molecular weight of 235.37 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2,3-dimethylcyclopentyl)-9-azabicyclo[3.3.1]nonan-3-one is sourced from PubChem (CID 64921492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).