About 3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine
3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine (PubChem CID 6492154) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is 3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine |
| PubChem CID | 6492154 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine |
| SMILES | Cc1nn(C)c(C)c1CCCN |
| InChI | InChI=1S/C9H17N3/c1-7-9(5-4-6-10)8(2)12(3)11-7/h4-6,10H2,1-3H3 |
| InChIKey | YOGPVQTVMDIBCK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine?
The IUPAC name of 3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine (CID 6492154) is 3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine.
What is the SMILES notation for 3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine?
The canonical SMILES for 3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine is Cc1nn(C)c(C)c1CCCN.
What is the InChIKey of 3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine?
The InChIKey is YOGPVQTVMDIBCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3/c1-7-9(5-4-6-10)8(2)12(3)11-7/h4-6,10H2,1-3H3.
What are the key properties of 3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine?
3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine has a molecular weight of 167.26 g/mol, XLogP of 0.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine is sourced from PubChem (CID 6492154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).