About 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid
2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid (PubChem CID 64922286) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid |
| PubChem CID | 64922286 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid |
| SMILES | CC1CCC(NCC(N)C(=O)O)C1C |
| InChI | InChI=1S/C10H20N2O2/c1-6-3-4-9(7(6)2)12-5-8(11)10(13)14/h6-9,12H,3-5,11H2,1-2H3,(H,13,14) |
| InChIKey | ZRIFXOATSRAIHJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid?
The IUPAC name of 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid (CID 64922286) is 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid.
What is the SMILES notation for 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid?
The canonical SMILES for 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid is CC1CCC(NCC(N)C(=O)O)C1C.
What is the InChIKey of 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid?
The InChIKey is ZRIFXOATSRAIHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-6-3-4-9(7(6)2)12-5-8(11)10(13)14/h6-9,12H,3-5,11H2,1-2H3,(H,13,14).
What are the key properties of 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid?
2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid has a molecular weight of 200.28 g/mol, XLogP of 0.42, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanoic acid is sourced from PubChem (CID 64922286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).