About 7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine
7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine (PubChem CID 64922438) has the molecular formula C14H17ClN2S
and a molecular weight of 280.82 g/mol. Its IUPAC name is 7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine |
| PubChem CID | 64922438 |
| Molecular Formula | C14H17ClN2S |
| Molecular Weight | 280.82 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine |
| SMILES | CC1CCC(Nc2nc3cccc(Cl)c3s2)C1C |
| InChI | InChI=1S/C14H17ClN2S/c1-8-6-7-11(9(8)2)16-14-17-12-5-3-4-10(15)13(12)18-14/h3-5,8-9,11H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | QJKLNKQUXQUMRO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.82 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine?
The IUPAC name of 7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine (CID 64922438) is 7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine.
What is the SMILES notation for 7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine?
The canonical SMILES for 7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine is CC1CCC(Nc2nc3cccc(Cl)c3s2)C1C.
What is the InChIKey of 7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine?
The InChIKey is QJKLNKQUXQUMRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClN2S/c1-8-6-7-11(9(8)2)16-14-17-12-5-3-4-10(15)13(12)18-14/h3-5,8-9,11H,6-7H2,1-2H3,(H,16,17).
What are the key properties of 7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine?
7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine has a molecular weight of 280.82 g/mol, XLogP of 4.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-N-(2,3-dimethylcyclopentyl)-1,3-benzothiazol-2-amine is sourced from PubChem (CID 64922438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).