2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid

C14H18FNO2 — CID 64922679

IUPAC2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid
SMILESCC1CCC(Nc2ccc(F)cc2C(=O)O)C1C
InChIInChI=1S/C14H18FNO2/c1-8-3-5-12(9(8)2)16-13-6-4-10(15)7-11(13)14(17)18/h4,6-9,12,16H,3,5H2,1-2H3,(H,17,18)
InChIKeyHZVXYUIOGMIBGN-UHFFFAOYSA-N
MW251.30 g/mol
LogP3.37
Rot. Bonds3

About 2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid

2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid (PubChem CID 64922679) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid.

Molecular Properties

Compound Name2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid
PubChem CID64922679
Molecular FormulaC14H18FNO2
Molecular Weight251.30 g/mol
Exact Mass251.13
IUPAC Name2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid
SMILESCC1CCC(Nc2ccc(F)cc2C(=O)O)C1C
InChIInChI=1S/C14H18FNO2/c1-8-3-5-12(9(8)2)16-13-6-4-10(15)7-11(13)14(17)18/h4,6-9,12,16H,3,5H2,1-2H3,(H,17,18)
InChIKeyHZVXYUIOGMIBGN-UHFFFAOYSA-N
XLogP3.37
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.30
LogP ≤ 53.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid?
The IUPAC name of 2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid (CID 64922679) is 2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid.
What is the SMILES notation for 2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid?
The canonical SMILES for 2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid is CC1CCC(Nc2ccc(F)cc2C(=O)O)C1C.
What is the InChIKey of 2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid?
The InChIKey is HZVXYUIOGMIBGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO2/c1-8-3-5-12(9(8)2)16-13-6-4-10(15)7-11(13)14(17)18/h4,6-9,12,16H,3,5H2,1-2H3,(H,17,18).
What are the key properties of 2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid?
2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid has a molecular weight of 251.30 g/mol, XLogP of 3.37, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-dimethylcyclopentyl)amino]-5-fluorobenzoic acid is sourced from PubChem (CID 64922679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).