About 5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide
5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide (PubChem CID 64923648) has the molecular formula C13H19N3O4S
and a molecular weight of 313.38 g/mol. Its IUPAC name is 5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide.
Molecular Properties
| Compound Name | 5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide |
| PubChem CID | 64923648 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)c2cc(N)ccc2[N+](=O)[O-])C1C |
| InChI | InChI=1S/C13H19N3O4S/c1-8-3-5-11(9(8)2)15-21(19,20)13-7-10(14)4-6-12(13)16(17)18/h4,6-9,11,15H,3,5,14H2,1-2H3 |
| InChIKey | RWJVTAKKYMCHJP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide?
The IUPAC name of 5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide (CID 64923648) is 5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide.
What is the SMILES notation for 5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide?
The canonical SMILES for 5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide is CC1CCC(NS(=O)(=O)c2cc(N)ccc2[N+](=O)[O-])C1C.
What is the InChIKey of 5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide?
The InChIKey is RWJVTAKKYMCHJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O4S/c1-8-3-5-11(9(8)2)15-21(19,20)13-7-10(14)4-6-12(13)16(17)18/h4,6-9,11,15H,3,5,14H2,1-2H3.
What are the key properties of 5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide?
5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide has a molecular weight of 313.38 g/mol, XLogP of 1.89, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(2,3-dimethylcyclopentyl)-2-nitrobenzenesulfonamide is sourced from PubChem (CID 64923648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).