About 3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine
3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine (PubChem CID 64923831) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine.
Molecular Properties
| Compound Name | 3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine |
| PubChem CID | 64923831 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine |
| SMILES | Cc1ccc(N2CCNC(C)(C3CC3)C2)cc1C |
| InChI | InChI=1S/C16H24N2/c1-12-4-7-15(10-13(12)2)18-9-8-17-16(3,11-18)14-5-6-14/h4,7,10,14,17H,5-6,8-9,11H2,1-3H3 |
| InChIKey | WOSCDCZZEIQKNK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine?
The IUPAC name of 3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine (CID 64923831) is 3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine.
What is the SMILES notation for 3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine?
The canonical SMILES for 3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine is Cc1ccc(N2CCNC(C)(C3CC3)C2)cc1C.
What is the InChIKey of 3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine?
The InChIKey is WOSCDCZZEIQKNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2/c1-12-4-7-15(10-13(12)2)18-9-8-17-16(3,11-18)14-5-6-14/h4,7,10,14,17H,5-6,8-9,11H2,1-3H3.
What are the key properties of 3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine?
3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine has a molecular weight of 244.38 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-1-(3,4-dimethylphenyl)-3-methylpiperazine is sourced from PubChem (CID 64923831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).