About 1-(4-butylphenyl)-3,3-diethylpiperazine
1-(4-butylphenyl)-3,3-diethylpiperazine (PubChem CID 64923865) has the molecular formula C18H30N2
and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3,3-diethylpiperazine.
Molecular Properties
| Compound Name | 1-(4-butylphenyl)-3,3-diethylpiperazine |
| PubChem CID | 64923865 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 1-(4-butylphenyl)-3,3-diethylpiperazine |
| SMILES | CCCCc1ccc(N2CCNC(CC)(CC)C2)cc1 |
| InChI | InChI=1S/C18H30N2/c1-4-7-8-16-9-11-17(12-10-16)20-14-13-19-18(5-2,6-3)15-20/h9-12,19H,4-8,13-15H2,1-3H3 |
| InChIKey | XRZMEHYGSCQPFH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-butylphenyl)-3,3-diethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-butylphenyl)-3,3-diethylpiperazine?
The IUPAC name of 1-(4-butylphenyl)-3,3-diethylpiperazine (CID 64923865) is 1-(4-butylphenyl)-3,3-diethylpiperazine.
What is the SMILES notation for 1-(4-butylphenyl)-3,3-diethylpiperazine?
The canonical SMILES for 1-(4-butylphenyl)-3,3-diethylpiperazine is CCCCc1ccc(N2CCNC(CC)(CC)C2)cc1.
What is the InChIKey of 1-(4-butylphenyl)-3,3-diethylpiperazine?
The InChIKey is XRZMEHYGSCQPFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2/c1-4-7-8-16-9-11-17(12-10-16)20-14-13-19-18(5-2,6-3)15-20/h9-12,19H,4-8,13-15H2,1-3H3.
What are the key properties of 1-(4-butylphenyl)-3,3-diethylpiperazine?
1-(4-butylphenyl)-3,3-diethylpiperazine has a molecular weight of 274.45 g/mol, XLogP of 4.00, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-butylphenyl)-3,3-diethylpiperazine is sourced from PubChem (CID 64923865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).