About 1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine
1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine (PubChem CID 64924440) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine.
Molecular Properties
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine |
| PubChem CID | 64924440 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine |
| SMILES | CCC1(CC)CN(c2ccc3c(c2)OCO3)CCN1 |
| InChI | InChI=1S/C15H22N2O2/c1-3-15(4-2)10-17(8-7-16-15)12-5-6-13-14(9-12)19-11-18-13/h5-6,9,16H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | URXOUNLZOJZASU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine?
The IUPAC name of 1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine (CID 64924440) is 1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine.
What is the SMILES notation for 1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine?
The canonical SMILES for 1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine is CCC1(CC)CN(c2ccc3c(c2)OCO3)CCN1.
What is the InChIKey of 1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine?
The InChIKey is URXOUNLZOJZASU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-3-15(4-2)10-17(8-7-16-15)12-5-6-13-14(9-12)19-11-18-13/h5-6,9,16H,3-4,7-8,10-11H2,1-2H3.
What are the key properties of 1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine?
1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine has a molecular weight of 262.35 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzodioxol-5-yl)-3,3-diethylpiperazine is sourced from PubChem (CID 64924440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).