About 1-(4-bromophenyl)-3,3-diethylpiperazine
1-(4-bromophenyl)-3,3-diethylpiperazine (PubChem CID 64925479) has the molecular formula C14H21BrN2
and a molecular weight of 297.24 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3,3-diethylpiperazine.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-3,3-diethylpiperazine |
| PubChem CID | 64925479 |
| Molecular Formula | C14H21BrN2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 1-(4-bromophenyl)-3,3-diethylpiperazine |
| SMILES | CCC1(CC)CN(c2ccc(Br)cc2)CCN1 |
| InChI | InChI=1S/C14H21BrN2/c1-3-14(4-2)11-17(10-9-16-14)13-7-5-12(15)6-8-13/h5-8,16H,3-4,9-11H2,1-2H3 |
| InChIKey | QKPTVOQVQUOPNE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-bromophenyl)-3,3-diethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-3,3-diethylpiperazine?
The IUPAC name of 1-(4-bromophenyl)-3,3-diethylpiperazine (CID 64925479) is 1-(4-bromophenyl)-3,3-diethylpiperazine.
What is the SMILES notation for 1-(4-bromophenyl)-3,3-diethylpiperazine?
The canonical SMILES for 1-(4-bromophenyl)-3,3-diethylpiperazine is CCC1(CC)CN(c2ccc(Br)cc2)CCN1.
What is the InChIKey of 1-(4-bromophenyl)-3,3-diethylpiperazine?
The InChIKey is QKPTVOQVQUOPNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrN2/c1-3-14(4-2)11-17(10-9-16-14)13-7-5-12(15)6-8-13/h5-8,16H,3-4,9-11H2,1-2H3.
What are the key properties of 1-(4-bromophenyl)-3,3-diethylpiperazine?
1-(4-bromophenyl)-3,3-diethylpiperazine has a molecular weight of 297.24 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-3,3-diethylpiperazine is sourced from PubChem (CID 64925479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).