C15H14N2OS — CID 649266
2-oxo-4-phenyl-6-prop-2-enylsulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 649266) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-oxo-4-phenyl-6-prop-2-enylsulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | 2-oxo-4-phenyl-6-prop-2-enylsulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 649266 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-oxo-4-phenyl-6-prop-2-enylsulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | C=CCSC1=C(C#N)C(c2ccccc2)CC(=O)N1 |
| InChI | InChI=1S/C15H14N2OS/c1-2-8-19-15-13(10-16)12(9-14(18)17-15)11-6-4-3-5-7-11/h2-7,12H,1,8-9H2,(H,17,18) |
| InChIKey | ZQMMDNKNXIHOKE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|