About 1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine
1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine (PubChem CID 64926759) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine |
| PubChem CID | 64926759 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine |
| SMILES | COc1ccc(C)cc1N1CCNC(C)(C)C1 |
| InChI | InChI=1S/C14H22N2O/c1-11-5-6-13(17-4)12(9-11)16-8-7-15-14(2,3)10-16/h5-6,9,15H,7-8,10H2,1-4H3 |
| InChIKey | VUJJHVMLGXKGRW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine?
The IUPAC name of 1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine (CID 64926759) is 1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine.
What is the SMILES notation for 1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine?
The canonical SMILES for 1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine is COc1ccc(C)cc1N1CCNC(C)(C)C1.
What is the InChIKey of 1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine?
The InChIKey is VUJJHVMLGXKGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O/c1-11-5-6-13(17-4)12(9-11)16-8-7-15-14(2,3)10-16/h5-6,9,15H,7-8,10H2,1-4H3.
What are the key properties of 1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine?
1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine has a molecular weight of 234.34 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxy-5-methylphenyl)-3,3-dimethylpiperazine is sourced from PubChem (CID 64926759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).