About 2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol
2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol (PubChem CID 64927048) has the molecular formula C13H18F2N2O
and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol |
| PubChem CID | 64927048 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol |
| SMILES | Nc1ccc(F)c(F)c1NCC1CCCCC1O |
| InChI | InChI=1S/C13H18F2N2O/c14-9-5-6-10(16)13(12(9)15)17-7-8-3-1-2-4-11(8)18/h5-6,8,11,17-18H,1-4,7,16H2 |
| InChIKey | PXNQPFQAGTXCGL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol?
The IUPAC name of 2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol (CID 64927048) is 2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol.
What is the SMILES notation for 2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol?
The canonical SMILES for 2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol is Nc1ccc(F)c(F)c1NCC1CCCCC1O.
What is the InChIKey of 2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol?
The InChIKey is PXNQPFQAGTXCGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2N2O/c14-9-5-6-10(16)13(12(9)15)17-7-8-3-1-2-4-11(8)18/h5-6,8,11,17-18H,1-4,7,16H2.
What are the key properties of 2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol?
2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol has a molecular weight of 256.30 g/mol, XLogP of 2.51, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-amino-2,3-difluoroanilino)methyl]cyclohexan-1-ol is sourced from PubChem (CID 64927048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).