C20H23N5O2 — CID 6492708
2-[(2,5-dimethylphenyl)methyl]-4,6,7,8-tetramethylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 6492708) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)methyl]-4,6,7,8-tetramethylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 2-[(2,5-dimethylphenyl)methyl]-4,6,7,8-tetramethylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 6492708 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)methyl]-4,6,7,8-tetramethylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cc1ccc(C)c(Cn2c(=O)c3c(nc4n(C)c(C)c(C)n34)n(C)c2=O)c1 |
| InChI | InChI=1S/C20H23N5O2/c1-11-7-8-12(2)15(9-11)10-24-18(26)16-17(23(6)20(24)27)21-19-22(5)13(3)14(4)25(16)19/h7-9H,10H2,1-6H3 |
| InChIKey | YLHMERUJQWEYTB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |