About N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide
N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 64927143) has the molecular formula C13H20N2O2S
and a molecular weight of 268.38 g/mol. Its IUPAC name is N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 64927143 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NCC2CCCCC2O)s1 |
| InChI | InChI=1S/C13H20N2O2S/c1-8-12(18-9(2)15-8)13(17)14-7-10-5-3-4-6-11(10)16/h10-11,16H,3-7H2,1-2H3,(H,14,17) |
| InChIKey | KDZQZUFBVZWVSQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide (CID 64927143) is N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide is Cc1nc(C)c(C(=O)NCC2CCCCC2O)s1.
What is the InChIKey of N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide?
The InChIKey is KDZQZUFBVZWVSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2S/c1-8-12(18-9(2)15-8)13(17)14-7-10-5-3-4-6-11(10)16/h10-11,16H,3-7H2,1-2H3,(H,14,17).
What are the key properties of N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide?
N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide has a molecular weight of 268.38 g/mol, XLogP of 2.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-hydroxycyclohexyl)methyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 64927143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).