About 2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol
2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol (PubChem CID 64928442) has the molecular formula C16H22N2OS
and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol |
| PubChem CID | 64928442 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol |
| SMILES | CC(NCC1CCCCC1O)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C16H22N2OS/c1-11(17-9-12-4-2-3-5-15(12)19)13-8-16-14(18-10-13)6-7-20-16/h6-8,10-12,15,17,19H,2-5,9H2,1H3 |
| InChIKey | QTJINZNHXDDQLB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol?
The IUPAC name of 2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol (CID 64928442) is 2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol.
What is the SMILES notation for 2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol?
The canonical SMILES for 2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol is CC(NCC1CCCCC1O)c1cnc2ccsc2c1.
What is the InChIKey of 2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol?
The InChIKey is QTJINZNHXDDQLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2OS/c1-11(17-9-12-4-2-3-5-15(12)19)13-8-16-14(18-10-13)6-7-20-16/h6-8,10-12,15,17,19H,2-5,9H2,1H3.
What are the key properties of 2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol?
2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol has a molecular weight of 290.43 g/mol, XLogP of 3.50, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-thieno[3,2-b]pyridin-6-ylethylamino)methyl]cyclohexan-1-ol is sourced from PubChem (CID 64928442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).