C13H15F5N2 — CID 64929068
N-[(2-aminocyclohexyl)methyl]-2,3,4,5,6-pentafluoroaniline (PubChem CID 64929068) has the molecular formula C13H15F5N2 and a molecular weight of 294.27 g/mol. Its IUPAC name is N-[(2-aminocyclohexyl)methyl]-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-[(2-aminocyclohexyl)methyl]-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 64929068 |
| Molecular Formula | C13H15F5N2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-[(2-aminocyclohexyl)methyl]-2,3,4,5,6-pentafluoroaniline |
| SMILES | NC1CCCCC1CNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H15F5N2/c14-8-9(15)11(17)13(12(18)10(8)16)20-5-6-3-1-2-4-7(6)19/h6-7,20H,1-5,19H2 |
| InChIKey | WFKOWPFEVFVFDV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|