C10H18ClNO2 — CID 64929109
2-chloro-N-[(2-hydroxycyclohexyl)methyl]propanamide (PubChem CID 64929109) has the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. Its IUPAC name is 2-chloro-N-[(2-hydroxycyclohexyl)methyl]propanamide.
| Compound Name | 2-chloro-N-[(2-hydroxycyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 64929109 |
| Molecular Formula | C10H18ClNO2 |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-chloro-N-[(2-hydroxycyclohexyl)methyl]propanamide |
| SMILES | CC(Cl)C(=O)NCC1CCCCC1O |
| InChI | InChI=1S/C10H18ClNO2/c1-7(11)10(14)12-6-8-4-2-3-5-9(8)13/h7-9,13H,2-6H2,1H3,(H,12,14) |
| InChIKey | BZDXGQJDCKLHQF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|