About 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol
4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol (PubChem CID 64929900) has the molecular formula C11H19N3O3
and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol.
Molecular Properties
| Compound Name | 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol |
| PubChem CID | 64929900 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol |
| SMILES | COc1ncnc(OC)c1CNCCC(C)O |
| InChI | InChI=1S/C11H19N3O3/c1-8(15)4-5-12-6-9-10(16-2)13-7-14-11(9)17-3/h7-8,12,15H,4-6H2,1-3H3 |
| InChIKey | FGOGHJSAEJNRGM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol?
The IUPAC name of 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol (CID 64929900) is 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol.
What is the SMILES notation for 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol?
The canonical SMILES for 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol is COc1ncnc(OC)c1CNCCC(C)O.
What is the InChIKey of 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol?
The InChIKey is FGOGHJSAEJNRGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3/c1-8(15)4-5-12-6-9-10(16-2)13-7-14-11(9)17-3/h7-8,12,15H,4-6H2,1-3H3.
What are the key properties of 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol?
4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol has a molecular weight of 241.29 g/mol, XLogP of 0.35, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butan-2-ol is sourced from PubChem (CID 64929900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).