About 1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine
1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine (PubChem CID 64930174) has the molecular formula C17H28N2
and a molecular weight of 260.43 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine.
Molecular Properties
| Compound Name | 1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine |
| PubChem CID | 64930174 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine |
| SMILES | CC1CNC(C)(C)CN1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H28N2/c1-13-11-18-17(5,6)12-19(13)15-9-7-14(8-10-15)16(2,3)4/h7-10,13,18H,11-12H2,1-6H3 |
| InChIKey | NCNNUTIEDQZYOK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine?
The IUPAC name of 1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine (CID 64930174) is 1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine.
What is the SMILES notation for 1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine?
The canonical SMILES for 1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine is CC1CNC(C)(C)CN1c1ccc(C(C)(C)C)cc1.
What is the InChIKey of 1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine?
The InChIKey is NCNNUTIEDQZYOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2/c1-13-11-18-17(5,6)12-19(13)15-9-7-14(8-10-15)16(2,3)4/h7-10,13,18H,11-12H2,1-6H3.
What are the key properties of 1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine?
1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine has a molecular weight of 260.43 g/mol, XLogP of 3.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butylphenyl)-2,5,5-trimethylpiperazine is sourced from PubChem (CID 64930174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).