C17H24N2 — CID 64930453
1,5-dicyclopropyl-5-methyl-2-phenylpiperazine (PubChem CID 64930453) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1,5-dicyclopropyl-5-methyl-2-phenylpiperazine.
| Compound Name | 1,5-dicyclopropyl-5-methyl-2-phenylpiperazine |
|---|---|
| PubChem CID | 64930453 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 1,5-dicyclopropyl-5-methyl-2-phenylpiperazine |
| SMILES | CC1(C2CC2)CN(C2CC2)C(c2ccccc2)CN1 |
| InChI | InChI=1S/C17H24N2/c1-17(14-7-8-14)12-19(15-9-10-15)16(11-18-17)13-5-3-2-4-6-13/h2-6,14-16,18H,7-12H2,1H3 |
| InChIKey | PRMWKEHKRRKJPO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |