C12H20N2S — CID 64930534
2-methyl-1-(1-thiophen-2-ylpropan-2-yl)piperazine (PubChem CID 64930534) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 2-methyl-1-(1-thiophen-2-ylpropan-2-yl)piperazine.
| Compound Name | 2-methyl-1-(1-thiophen-2-ylpropan-2-yl)piperazine |
|---|---|
| PubChem CID | 64930534 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-methyl-1-(1-thiophen-2-ylpropan-2-yl)piperazine |
| SMILES | CC1CNCCN1C(C)Cc1cccs1 |
| InChI | InChI=1S/C12H20N2S/c1-10(8-12-4-3-7-15-12)14-6-5-13-9-11(14)2/h3-4,7,10-11,13H,5-6,8-9H2,1-2H3 |
| InChIKey | SZUCRAAOWBGTFW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |