About methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate
methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate (PubChem CID 649308) has the molecular formula C15H22N4O3
and a molecular weight of 306.37 g/mol. Its IUPAC name is methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate |
| PubChem CID | 649308 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)C1CCN(c2nc(C)cc(C)n2)CC1 |
| InChI | InChI=1S/C15H22N4O3/c1-10-8-11(2)18-15(17-10)19-6-4-12(5-7-19)14(21)16-9-13(20)22-3/h8,12H,4-7,9H2,1-3H3,(H,16,21) |
| InChIKey | LZBLNQHIGVOQON-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate?
The IUPAC name of methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate (CID 649308) is methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate.
What is the SMILES notation for methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate?
The canonical SMILES for methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate is COC(=O)CNC(=O)C1CCN(c2nc(C)cc(C)n2)CC1.
What is the InChIKey of methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate?
The InChIKey is LZBLNQHIGVOQON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O3/c1-10-8-11(2)18-15(17-10)19-6-4-12(5-7-19)14(21)16-9-13(20)22-3/h8,12H,4-7,9H2,1-3H3,(H,16,21).
What are the key properties of methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate?
methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate has a molecular weight of 306.37 g/mol, XLogP of 0.60, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbonyl]amino]acetate is sourced from PubChem (CID 649308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).