About 1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine
1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine (PubChem CID 64930956) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine.
Molecular Properties
| Compound Name | 1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine |
| PubChem CID | 64930956 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine |
| SMILES | CCOc1ccc(N2CC(C)(C)NCC2C)cc1 |
| InChI | InChI=1S/C15H24N2O/c1-5-18-14-8-6-13(7-9-14)17-11-15(3,4)16-10-12(17)2/h6-9,12,16H,5,10-11H2,1-4H3 |
| InChIKey | OJFURFFJCVJOSI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine?
The IUPAC name of 1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine (CID 64930956) is 1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine.
What is the SMILES notation for 1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine?
The canonical SMILES for 1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine is CCOc1ccc(N2CC(C)(C)NCC2C)cc1.
What is the InChIKey of 1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine?
The InChIKey is OJFURFFJCVJOSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O/c1-5-18-14-8-6-13(7-9-14)17-11-15(3,4)16-10-12(17)2/h6-9,12,16H,5,10-11H2,1-4H3.
What are the key properties of 1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine?
1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine has a molecular weight of 248.37 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethoxyphenyl)-2,5,5-trimethylpiperazine is sourced from PubChem (CID 64930956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).