C16H24N2O2 — CID 64931800
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethyl-5,5-dimethylpiperazine (PubChem CID 64931800) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethyl-5,5-dimethylpiperazine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethyl-5,5-dimethylpiperazine |
|---|---|
| PubChem CID | 64931800 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethyl-5,5-dimethylpiperazine |
| SMILES | CCC1CNC(C)(C)CN1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H24N2O2/c1-4-12-10-17-16(2,3)11-18(12)13-5-6-14-15(9-13)20-8-7-19-14/h5-6,9,12,17H,4,7-8,10-11H2,1-3H3 |
| InChIKey | WESAEDDWKSGXKH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|