C16H26N2 — CID 64931944
1-(2,5-dimethylphenyl)-2,5-diethylpiperazine (PubChem CID 64931944) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2,5-diethylpiperazine.
| Compound Name | 1-(2,5-dimethylphenyl)-2,5-diethylpiperazine |
|---|---|
| PubChem CID | 64931944 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2,5-diethylpiperazine |
| SMILES | CCC1CN(c2cc(C)ccc2C)C(CC)CN1 |
| InChI | InChI=1S/C16H26N2/c1-5-14-11-18(15(6-2)10-17-14)16-9-12(3)7-8-13(16)4/h7-9,14-15,17H,5-6,10-11H2,1-4H3 |
| InChIKey | YXHKAOOPQQQAQX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |