About 3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide
3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 6493258) has the molecular formula C11H11N3O3S2
and a molecular weight of 297.36 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide |
| PubChem CID | 6493258 |
| Molecular Formula | C11H11N3O3S2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccccc1)Nc1nncs1 |
| InChI | InChI=1S/C11H11N3O3S2/c15-10(13-11-14-12-8-18-11)6-7-19(16,17)9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,13,14,15) |
| InChIKey | ADCQIRNYPJAMEL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide?
The IUPAC name of 3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide (CID 6493258) is 3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide.
What is the SMILES notation for 3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide?
The canonical SMILES for 3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide is O=C(CCS(=O)(=O)c1ccccc1)Nc1nncs1.
What is the InChIKey of 3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide?
The InChIKey is ADCQIRNYPJAMEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3S2/c15-10(13-11-14-12-8-18-11)6-7-19(16,17)9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,13,14,15).
What are the key properties of 3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide?
3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide has a molecular weight of 297.36 g/mol, XLogP of 1.34, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-N-(1,3,4-thiadiazol-2-yl)propanamide is sourced from PubChem (CID 6493258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).