C13H16F4N2 — CID 64933076
2-ethyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]piperazine (PubChem CID 64933076) has the molecular formula C13H16F4N2 and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-ethyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 2-ethyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 64933076 |
| Molecular Formula | C13H16F4N2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-ethyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]piperazine |
| SMILES | CCC1CNCCN1c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F4N2/c1-2-9-8-18-5-6-19(9)10-3-4-12(14)11(7-10)13(15,16)17/h3-4,7,9,18H,2,5-6,8H2,1H3 |
| InChIKey | SHTIVXSNWZAPFL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |