C13H16N4O4S — CID 649339
ethyl 2-[1-(2,5-dimethoxyphenyl)tetrazol-5-yl]sulfanylacetate (PubChem CID 649339) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is ethyl 2-[1-(2,5-dimethoxyphenyl)tetrazol-5-yl]sulfanylacetate.
| Compound Name | ethyl 2-[1-(2,5-dimethoxyphenyl)tetrazol-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 649339 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | ethyl 2-[1-(2,5-dimethoxyphenyl)tetrazol-5-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1nnnn1-c1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H16N4O4S/c1-4-21-12(18)8-22-13-14-15-16-17(13)10-7-9(19-2)5-6-11(10)20-3/h5-7H,4,8H2,1-3H3 |
| InChIKey | UEBSXYXUXONPLH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |