About N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine
N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 6493402) has the molecular formula C12H24N2S
and a molecular weight of 228.40 g/mol. Its IUPAC name is N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine.
Molecular Properties
| Compound Name | N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| PubChem CID | 6493402 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | CCCCCC(CC)NC1=NCCCS1 |
| InChI | InChI=1S/C12H24N2S/c1-3-5-6-8-11(4-2)14-12-13-9-7-10-15-12/h11H,3-10H2,1-2H3,(H,13,14) |
| InChIKey | RZLHBHXUSDTSDT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine?
The IUPAC name of N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine (CID 6493402) is N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine.
What is the SMILES notation for N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine?
The canonical SMILES for N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine is CCCCCC(CC)NC1=NCCCS1.
What is the InChIKey of N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine?
The InChIKey is RZLHBHXUSDTSDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2S/c1-3-5-6-8-11(4-2)14-12-13-9-7-10-15-12/h11H,3-10H2,1-2H3,(H,13,14).
What are the key properties of N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine?
N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine has a molecular weight of 228.40 g/mol, XLogP of 3.43, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-octan-3-yl-5,6-dihydro-4H-1,3-thiazin-2-amine is sourced from PubChem (CID 6493402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).