C15H20Cl2N2 — CID 64934485
5-cyclopropyl-1-(2,4-dichlorophenyl)-2,5-dimethylpiperazine (PubChem CID 64934485) has the molecular formula C15H20Cl2N2 and a molecular weight of 299.24 g/mol. Its IUPAC name is 5-cyclopropyl-1-(2,4-dichlorophenyl)-2,5-dimethylpiperazine.
| Compound Name | 5-cyclopropyl-1-(2,4-dichlorophenyl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 64934485 |
| Molecular Formula | C15H20Cl2N2 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-cyclopropyl-1-(2,4-dichlorophenyl)-2,5-dimethylpiperazine |
| SMILES | CC1CNC(C)(C2CC2)CN1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H20Cl2N2/c1-10-8-18-15(2,11-3-4-11)9-19(10)14-6-5-12(16)7-13(14)17/h5-7,10-11,18H,3-4,8-9H2,1-2H3 |
| InChIKey | NGVZKZNSFCJCBB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |