About 1-(4-iodophenyl)-2,5,5-trimethylpiperazine
1-(4-iodophenyl)-2,5,5-trimethylpiperazine (PubChem CID 64935112) has the molecular formula C13H19IN2
and a molecular weight of 330.21 g/mol. Its IUPAC name is 1-(4-iodophenyl)-2,5,5-trimethylpiperazine.
Molecular Properties
| Compound Name | 1-(4-iodophenyl)-2,5,5-trimethylpiperazine |
| PubChem CID | 64935112 |
| Molecular Formula | C13H19IN2 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 1-(4-iodophenyl)-2,5,5-trimethylpiperazine |
| SMILES | CC1CNC(C)(C)CN1c1ccc(I)cc1 |
| InChI | InChI=1S/C13H19IN2/c1-10-8-15-13(2,3)9-16(10)12-6-4-11(14)5-7-12/h4-7,10,15H,8-9H2,1-3H3 |
| InChIKey | QCAKKNQVXMCDDX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-iodophenyl)-2,5,5-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-iodophenyl)-2,5,5-trimethylpiperazine?
The IUPAC name of 1-(4-iodophenyl)-2,5,5-trimethylpiperazine (CID 64935112) is 1-(4-iodophenyl)-2,5,5-trimethylpiperazine.
What is the SMILES notation for 1-(4-iodophenyl)-2,5,5-trimethylpiperazine?
The canonical SMILES for 1-(4-iodophenyl)-2,5,5-trimethylpiperazine is CC1CNC(C)(C)CN1c1ccc(I)cc1.
What is the InChIKey of 1-(4-iodophenyl)-2,5,5-trimethylpiperazine?
The InChIKey is QCAKKNQVXMCDDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19IN2/c1-10-8-15-13(2,3)9-16(10)12-6-4-11(14)5-7-12/h4-7,10,15H,8-9H2,1-3H3.
What are the key properties of 1-(4-iodophenyl)-2,5,5-trimethylpiperazine?
1-(4-iodophenyl)-2,5,5-trimethylpiperazine has a molecular weight of 330.21 g/mol, XLogP of 2.87, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-iodophenyl)-2,5,5-trimethylpiperazine is sourced from PubChem (CID 64935112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).