C15H23ClN2O2 — CID 64935468
1-(4-chloro-2,5-dimethoxyphenyl)-2,5,5-trimethylpiperazine (PubChem CID 64935468) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-2,5,5-trimethylpiperazine.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-2,5,5-trimethylpiperazine |
|---|---|
| PubChem CID | 64935468 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-2,5,5-trimethylpiperazine |
| SMILES | COc1cc(N2CC(C)(C)NCC2C)c(OC)cc1Cl |
| InChI | InChI=1S/C15H23ClN2O2/c1-10-8-17-15(2,3)9-18(10)12-7-13(19-4)11(16)6-14(12)20-5/h6-7,10,17H,8-9H2,1-5H3 |
| InChIKey | IJOCANZFUQXTCB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |