C16H16Cl2N2 — CID 64939175
1-(3,4-dichlorophenyl)-2-phenylpiperazine (PubChem CID 64939175) has the molecular formula C16H16Cl2N2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-phenylpiperazine.
| Compound Name | 1-(3,4-dichlorophenyl)-2-phenylpiperazine |
|---|---|
| PubChem CID | 64939175 |
| Molecular Formula | C16H16Cl2N2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-phenylpiperazine |
| SMILES | Clc1ccc(N2CCNCC2c2ccccc2)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N2/c17-14-7-6-13(10-15(14)18)20-9-8-19-11-16(20)12-4-2-1-3-5-12/h1-7,10,16,19H,8-9,11H2 |
| InChIKey | YLZRCXFAUIFGQO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |