C16H23F3N2 — CID 64940187
2-propan-2-yl-5-propyl-1-(2,3,5-trifluorophenyl)piperazine (PubChem CID 64940187) has the molecular formula C16H23F3N2 and a molecular weight of 300.37 g/mol. Its IUPAC name is 2-propan-2-yl-5-propyl-1-(2,3,5-trifluorophenyl)piperazine.
| Compound Name | 2-propan-2-yl-5-propyl-1-(2,3,5-trifluorophenyl)piperazine |
|---|---|
| PubChem CID | 64940187 |
| Molecular Formula | C16H23F3N2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-propan-2-yl-5-propyl-1-(2,3,5-trifluorophenyl)piperazine |
| SMILES | CCCC1CN(c2cc(F)cc(F)c2F)C(C(C)C)CN1 |
| InChI | InChI=1S/C16H23F3N2/c1-4-5-12-9-21(15(8-20-12)10(2)3)14-7-11(17)6-13(18)16(14)19/h6-7,10,12,15,20H,4-5,8-9H2,1-3H3 |
| InChIKey | PQVLBXGAHKVJMW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|