C15H19F3N2 — CID 64940762
5-cyclopropyl-2-ethyl-1-(2,4,5-trifluorophenyl)piperazine (PubChem CID 64940762) has the molecular formula C15H19F3N2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 5-cyclopropyl-2-ethyl-1-(2,4,5-trifluorophenyl)piperazine.
| Compound Name | 5-cyclopropyl-2-ethyl-1-(2,4,5-trifluorophenyl)piperazine |
|---|---|
| PubChem CID | 64940762 |
| Molecular Formula | C15H19F3N2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 5-cyclopropyl-2-ethyl-1-(2,4,5-trifluorophenyl)piperazine |
| SMILES | CCC1CNC(C2CC2)CN1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H19F3N2/c1-2-10-7-19-14(9-3-4-9)8-20(10)15-6-12(17)11(16)5-13(15)18/h5-6,9-10,14,19H,2-4,7-8H2,1H3 |
| InChIKey | ZXJMNRQJEQFLCJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|